About 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene
1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene (PubChem CID 177054127) has the molecular formula C11H22FN
and a molecular weight of 187.30 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene |
| PubChem CID | 177054127 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene |
| SMILES | C=CC(C)CF.CC1CCN(C)C1 |
| InChI | InChI=1S/C6H13N.C5H9F/c1-6-3-4-7(2)5-6;1-3-5(2)4-6/h6H,3-5H2,1-2H3;3,5H,1,4H2,2H3 |
| InChIKey | YGZHJYYGRBINDF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene?
The IUPAC name of 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene (CID 177054127) is 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene.
What is the SMILES notation for 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene?
The canonical SMILES for 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene is C=CC(C)CF.CC1CCN(C)C1.
What is the InChIKey of 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene?
The InChIKey is YGZHJYYGRBINDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H9F/c1-6-3-4-7(2)5-6;1-3-5(2)4-6/h6H,3-5H2,1-2H3;3,5H,1,4H2,2H3.
What are the key properties of 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene?
1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene has a molecular weight of 187.30 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolidine;4-fluoro-3-methylbut-1-ene is sourced from PubChem (CID 177054127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).