C8H12N2 — CID 177054530
(2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine (PubChem CID 177054530) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine.
| Compound Name | (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine |
|---|---|
| PubChem CID | 177054530 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine |
| SMILES | CC1=C/CC/C=C(N)/C=N\1 |
| InChI | InChI=1S/C8H12N2/c1-7-4-2-3-5-8(9)6-10-7/h4-6H,2-3,9H2,1H3/b7-4-,8-5+,10-6- |
| InChIKey | SJWSNCMPPFBVKI-XTWUXGCBSA-N |
| XLogP | 1.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |