About (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine
(2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine (PubChem CID 177054530) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine.
Molecular Properties
| Compound Name | (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine |
| PubChem CID | 177054530 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine |
| SMILES | CC1=C/CC/C=C(N)/C=N\1 |
| InChI | InChI=1S/C8H12N2/c1-7-4-2-3-5-8(9)6-10-7/h4-6H,2-3,9H2,1H3/b7-4-,8-5+,10-6- |
| InChIKey | SJWSNCMPPFBVKI-XTWUXGCBSA-N |
| XLogP | 1.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine?
The IUPAC name of (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine (CID 177054530) is (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine.
What is the SMILES notation for (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine?
The canonical SMILES for (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine is CC1=C/CC/C=C(N)/C=N\1.
What is the InChIKey of (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine?
The InChIKey is SJWSNCMPPFBVKI-XTWUXGCBSA-N. The full InChI is InChI=1S/C8H12N2/c1-7-4-2-3-5-8(9)6-10-7/h4-6H,2-3,9H2,1H3/b7-4-,8-5+,10-6-.
What are the key properties of (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine?
(2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine has a molecular weight of 136.20 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,6E)-2-methyl-4,5-dihydroazocin-7-amine is sourced from PubChem (CID 177054530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).