C31H50N6O4 — CID 177054884
cyclohexane;N-[[6-(ethylamino)-2-methylpyrimidin-4-yl]methyl]-4-[3-(methoxymethyl)pyrrolidin-1-yl]benzamide;N-(2-methoxyethyl)formamide (PubChem CID 177054884) has the molecular formula C31H50N6O4 and a molecular weight of 570.78 g/mol. Its IUPAC name is cyclohexane;N-[[6-(ethylamino)-2-methylpyrimidin-4-yl]methyl]-4-[3-(methoxymethyl)pyrrolidin-1-yl]benzamide;N-(2-methoxyethyl)formamide.
| Compound Name | cyclohexane;N-[[6-(ethylamino)-2-methylpyrimidin-4-yl]methyl]-4-[3-(methoxymethyl)pyrrolidin-1-yl]benzamide;N-(2-methoxyethyl)formamide |
|---|---|
| PubChem CID | 177054884 |
| Molecular Formula | C31H50N6O4 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | cyclohexane;N-[[6-(ethylamino)-2-methylpyrimidin-4-yl]methyl]-4-[3-(methoxymethyl)pyrrolidin-1-yl]benzamide;N-(2-methoxyethyl)formamide |
| SMILES | C1CCCCC1.CCNc1cc(CNC(=O)c2ccc(N3CCC(COC)C3)cc2)nc(C)n1.COCCNC=O |
| InChI | InChI=1S/C21H29N5O2.C6H12.C4H9NO2/c1-4-22-20-11-18(24-15(2)25-20)12-23-21(27)17-5-7-19(8-6-17)26-10-9-16(13-26)14-28-3;1-2-4-6-5-3-1;1-7-3-2-5-4-6/h5-8,11,16H,4,9-10,12-14H2,1-3H3,(H,23,27)(H,22,24,25);1-6H2;4H,2-3H2,1H3,(H,5,6) |
| InChIKey | XMVYTHBALOOMJQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|