C10H18N2O2 — CID 177056000
4-hydroxy-N-[[(2R)-pyrrolidin-2-yl]methyl]pent-4-enamide (PubChem CID 177056000) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-hydroxy-N-[[(2R)-pyrrolidin-2-yl]methyl]pent-4-enamide.
| Compound Name | 4-hydroxy-N-[[(2R)-pyrrolidin-2-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 177056000 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4-hydroxy-N-[[(2R)-pyrrolidin-2-yl]methyl]pent-4-enamide |
| SMILES | C=C(O)CCC(=O)NC[C@H]1CCCN1 |
| InChI | InChI=1S/C10H18N2O2/c1-8(13)4-5-10(14)12-7-9-3-2-6-11-9/h9,11,13H,1-7H2,(H,12,14)/t9-/m1/s1 |
| InChIKey | BYTBVCMFCZWBGM-SECBINFHSA-N |
| XLogP | 0.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|