C15H19N2O2Re- — CID 177057057
1-(3-methyl-5-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-1,3-diazinane-2,4-dione;rhenium (PubChem CID 177057057) has the molecular formula C15H19N2O2Re- and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-(3-methyl-5-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-1,3-diazinane-2,4-dione;rhenium.
| Compound Name | 1-(3-methyl-5-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-1,3-diazinane-2,4-dione;rhenium |
|---|---|
| PubChem CID | 177057057 |
| Molecular Formula | C15H19N2O2Re- |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-(3-methyl-5-propan-2-ylcyclohepta-1,4,6-trien-1-yl)-1,3-diazinane-2,4-dione;rhenium |
| SMILES | C[C-]1C=C(C(C)C)C=CC(N2CCC(=O)NC2=O)=C1.[Re] |
| InChI | InChI=1S/C15H19N2O2.Re/c1-10(2)12-4-5-13(9-11(3)8-12)17-7-6-14(18)16-15(17)19;/h4-5,8-10H,6-7H2,1-3H3,(H,16,18,19);/q-1; |
| InChIKey | FROLELSOZRQNGR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|