C16H17BrF2N4O2S — CID 177057195
N-[1-(3-bromophenyl)sulfinylpiperidin-4-yl]-5-(difluoromethoxy)pyrimidin-2-amine (PubChem CID 177057195) has the molecular formula C16H17BrF2N4O2S and a molecular weight of 447.31 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)sulfinylpiperidin-4-yl]-5-(difluoromethoxy)pyrimidin-2-amine.
| Compound Name | N-[1-(3-bromophenyl)sulfinylpiperidin-4-yl]-5-(difluoromethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 177057195 |
| Molecular Formula | C16H17BrF2N4O2S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | N-[1-(3-bromophenyl)sulfinylpiperidin-4-yl]-5-(difluoromethoxy)pyrimidin-2-amine |
| SMILES | O=S(c1cccc(Br)c1)N1CCC(Nc2ncc(OC(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H17BrF2N4O2S/c17-11-2-1-3-14(8-11)26(24)23-6-4-12(5-7-23)22-16-20-9-13(10-21-16)25-15(18)19/h1-3,8-10,12,15H,4-7H2,(H,20,21,22) |
| InChIKey | CZVCTGVMCBZNGS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |