About ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile
ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile (PubChem CID 177057337) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile.
Molecular Properties
| Compound Name | ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile |
| PubChem CID | 177057337 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile |
| SMILES | C=CC#N.CC.COCCN(C)CCC#N |
| InChI | InChI=1S/C7H14N2O.C3H3N.C2H6/c1-9(5-3-4-8)6-7-10-2;1-2-3-4;1-2/h3,5-7H2,1-2H3;2H,1H2;1-2H3 |
| InChIKey | KPRCUOMBVBREHB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile?
The IUPAC name of ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile (CID 177057337) is ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile.
What is the SMILES notation for ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile?
The canonical SMILES for ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile is C=CC#N.CC.COCCN(C)CCC#N.
What is the InChIKey of ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile?
The InChIKey is KPRCUOMBVBREHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.C3H3N.C2H6/c1-9(5-3-4-8)6-7-10-2;1-2-3-4;1-2/h3,5-7H2,1-2H3;2H,1H2;1-2H3.
What are the key properties of ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile?
ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile has a molecular weight of 225.34 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[2-methoxyethyl(methyl)amino]propanenitrile;prop-2-enenitrile is sourced from PubChem (CID 177057337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).