About 2-cyclohexyloxy-4,5,6-trimethylpyrimidine
2-cyclohexyloxy-4,5,6-trimethylpyrimidine (PubChem CID 177057450) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-cyclohexyloxy-4,5,6-trimethylpyrimidine.
Molecular Properties
| Compound Name | 2-cyclohexyloxy-4,5,6-trimethylpyrimidine |
| PubChem CID | 177057450 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-cyclohexyloxy-4,5,6-trimethylpyrimidine |
| SMILES | Cc1nc(OC2CCCCC2)nc(C)c1C |
| InChI | InChI=1S/C13H20N2O/c1-9-10(2)14-13(15-11(9)3)16-12-7-5-4-6-8-12/h12H,4-8H2,1-3H3 |
| InChIKey | QYYZJJSFOVZNEZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyloxy-4,5,6-trimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxy-4,5,6-trimethylpyrimidine?
The IUPAC name of 2-cyclohexyloxy-4,5,6-trimethylpyrimidine (CID 177057450) is 2-cyclohexyloxy-4,5,6-trimethylpyrimidine.
What is the SMILES notation for 2-cyclohexyloxy-4,5,6-trimethylpyrimidine?
The canonical SMILES for 2-cyclohexyloxy-4,5,6-trimethylpyrimidine is Cc1nc(OC2CCCCC2)nc(C)c1C.
What is the InChIKey of 2-cyclohexyloxy-4,5,6-trimethylpyrimidine?
The InChIKey is QYYZJJSFOVZNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-9-10(2)14-13(15-11(9)3)16-12-7-5-4-6-8-12/h12H,4-8H2,1-3H3.
What are the key properties of 2-cyclohexyloxy-4,5,6-trimethylpyrimidine?
2-cyclohexyloxy-4,5,6-trimethylpyrimidine has a molecular weight of 220.32 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxy-4,5,6-trimethylpyrimidine is sourced from PubChem (CID 177057450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).