C24H20N4O4 — CID 177057688
4-[2-[5-[2-(cyanoamino)ethoxy]-2-methoxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzoic acid (PubChem CID 177057688) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 4-[2-[5-[2-(cyanoamino)ethoxy]-2-methoxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzoic acid.
| Compound Name | 4-[2-[5-[2-(cyanoamino)ethoxy]-2-methoxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 177057688 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[2-[5-[2-(cyanoamino)ethoxy]-2-methoxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzoic acid |
| SMILES | COc1ccc(OCCNC#N)cc1-c1cc2c(-c3ccc(C(=O)O)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C24H20N4O4/c1-31-22-7-6-17(32-11-10-26-14-25)12-20(22)21-13-19-18(8-9-27-23(19)28-21)15-2-4-16(5-3-15)24(29)30/h2-9,12-13,26H,10-11H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | IJVKUZCOCGJMPK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|