C30H59N3O14 — CID 177057800
7-(2,5-dimethylhexan-2-yloxy)-5-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)-4-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]heptanamide (PubChem CID 177057800) has the molecular formula C30H59N3O14 and a molecular weight of 685.81 g/mol. Its IUPAC name is 7-(2,5-dimethylhexan-2-yloxy)-5-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)-4-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]heptanamide.
| Compound Name | 7-(2,5-dimethylhexan-2-yloxy)-5-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)-4-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]heptanamide |
|---|---|
| PubChem CID | 177057800 |
| Molecular Formula | C30H59N3O14 |
| Molecular Weight | 685.81 g/mol |
| Exact Mass | 685.40 |
| IUPAC Name | 7-(2,5-dimethylhexan-2-yloxy)-5-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)-4-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyl]heptanamide |
| SMILES | CC(C)CCC(C)(C)OCCC(C)C(CCNC(=O)C(O)C(O)C(O)C(O)CO)CC(NC(=O)C(O)C(O)C(O)C(O)CO)C(N)=O |
| InChI | InChI=1S/C30H59N3O14/c1-15(2)6-9-30(4,5)47-11-8-16(3)17(7-10-32-28(45)25(42)23(40)21(38)19(36)13-34)12-18(27(31)44)33-29(46)26(43)24(41)22(39)20(37)14-35/h15-26,34-43H,6-14H2,1-5H3,(H2,31,44)(H,32,45)(H,33,46) |
| InChIKey | MAWLBKFYGLTCLK-UHFFFAOYSA-N |
| XLogP | -4.40 |
| TPSA | 312.82 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.81 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |