About 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride
2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride (PubChem CID 177057865) has the molecular formula C14H15ClF3N3OS
and a molecular weight of 365.81 g/mol. Its IUPAC name is 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride.
Molecular Properties
| Compound Name | 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride |
| PubChem CID | 177057865 |
| Molecular Formula | C14H15ClF3N3OS |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride |
| SMILES | FC(F)(F)c1nnc(Oc2ccc(C3CC[NH2+]CC3)cc2)s1.[Cl-] |
| InChI | InChI=1S/C14H14F3N3OS.ClH/c15-14(16,17)12-19-20-13(22-12)21-11-3-1-9(2-4-11)10-5-7-18-8-6-10;/h1-4,10,18H,5-8H2;1H |
| InChIKey | FENLWPHAQZYLHM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride?
The IUPAC name of 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride (CID 177057865) is 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride.
What is the SMILES notation for 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride?
The canonical SMILES for 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride is FC(F)(F)c1nnc(Oc2ccc(C3CC[NH2+]CC3)cc2)s1.[Cl-].
What is the InChIKey of 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride?
The InChIKey is FENLWPHAQZYLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3OS.ClH/c15-14(16,17)12-19-20-13(22-12)21-11-3-1-9(2-4-11)10-5-7-18-8-6-10;/h1-4,10,18H,5-8H2;1H.
What are the key properties of 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride?
2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride has a molecular weight of 365.81 g/mol, XLogP of -0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-piperidin-1-ium-4-ylphenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole chloride is sourced from PubChem (CID 177057865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).