C17H10Cl3F6NO — CID 177058015
bis[4-(trifluoromethyl)phenyl]methyl 2,2,2-trichloroethanimidate (PubChem CID 177058015) has the molecular formula C17H10Cl3F6NO and a molecular weight of 464.62 g/mol. Its IUPAC name is bis[4-(trifluoromethyl)phenyl]methyl 2,2,2-trichloroethanimidate.
| Compound Name | bis[4-(trifluoromethyl)phenyl]methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 177058015 |
| Molecular Formula | C17H10Cl3F6NO |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | bis[4-(trifluoromethyl)phenyl]methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H10Cl3F6NO/c18-15(19,20)14(27)28-13(9-1-5-11(6-2-9)16(21,22)23)10-3-7-12(8-4-10)17(24,25)26/h1-8,13,27H/b27-14+ |
| InChIKey | CUUAPUGIYLBAOB-MZJWZYIUSA-N |
| XLogP | 7.18 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|