C22H30F3NO3 — CID 177058021
(4aR,6R)-1-[(2S)-1-hydroxy-3-methylbutan-2-yl]-6-[[4-(trifluoromethyl)phenyl]methoxy]-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one (PubChem CID 177058021) has the molecular formula C22H30F3NO3 and a molecular weight of 413.48 g/mol. Its IUPAC name is (4aR,6R)-1-[(2S)-1-hydroxy-3-methylbutan-2-yl]-6-[[4-(trifluoromethyl)phenyl]methoxy]-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one.
| Compound Name | (4aR,6R)-1-[(2S)-1-hydroxy-3-methylbutan-2-yl]-6-[[4-(trifluoromethyl)phenyl]methoxy]-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
|---|---|
| PubChem CID | 177058021 |
| Molecular Formula | C22H30F3NO3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (4aR,6R)-1-[(2S)-1-hydroxy-3-methylbutan-2-yl]-6-[[4-(trifluoromethyl)phenyl]methoxy]-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
| SMILES | CC(C)[C@@H](CO)N1C(=O)CC[C@@H]2C[C@H](OCc3ccc(C(F)(F)F)cc3)CCC21 |
| InChI | InChI=1S/C22H30F3NO3/c1-14(2)20(12-27)26-19-9-8-18(11-16(19)5-10-21(26)28)29-13-15-3-6-17(7-4-15)22(23,24)25/h3-4,6-7,14,16,18-20,27H,5,8-13H2,1-2H3/t16-,18-,19?,20-/m1/s1 |
| InChIKey | RDISSSWUXPFPSB-DNJPBYLQSA-N |
| XLogP | 4.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |