C31H51N5O8 — CID 177058128
2,6-bis[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[2-methyl-1-(2-methylbutan-2-yloxy)propan-2-yl]hexanamide (PubChem CID 177058128) has the molecular formula C31H51N5O8 and a molecular weight of 621.78 g/mol. Its IUPAC name is 2,6-bis[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[2-methyl-1-(2-methylbutan-2-yloxy)propan-2-yl]hexanamide.
| Compound Name | 2,6-bis[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[2-methyl-1-(2-methylbutan-2-yloxy)propan-2-yl]hexanamide |
|---|---|
| PubChem CID | 177058128 |
| Molecular Formula | C31H51N5O8 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.37 |
| IUPAC Name | 2,6-bis[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-N-[2-methyl-1-(2-methylbutan-2-yloxy)propan-2-yl]hexanamide |
| SMILES | CCC(C)(C)OCC(C)(C)NC(=O)C(CCCCNC(=O)CCN1C(=O)CC(C)C1=O)NC(=O)CCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C31H51N5O8/c1-8-31(6,7)44-19-30(4,5)34-27(41)22(33-24(38)13-16-36-26(40)18-21(3)29(36)43)11-9-10-14-32-23(37)12-15-35-25(39)17-20(2)28(35)42/h20-22H,8-19H2,1-7H3,(H,32,37)(H,33,38)(H,34,41) |
| InChIKey | KKYOFRNCSPCAJC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|