About ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane
ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane (PubChem CID 177059114) has the molecular formula C15H30FNO
and a molecular weight of 259.41 g/mol. Its IUPAC name is ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane.
Molecular Properties
| Compound Name | ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane |
| PubChem CID | 177059114 |
| Molecular Formula | C15H30FNO |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane |
| SMILES | C=C1CC[C@@](F)(C(N)=O)CC1(C)C.CC.CCC |
| InChI | InChI=1S/C10H16FNO.C3H8.C2H6/c1-7-4-5-10(11,8(12)13)6-9(7,2)3;1-3-2;1-2/h1,4-6H2,2-3H3,(H2,12,13);3H2,1-2H3;1-2H3/t10-;;/m0../s1 |
| InChIKey | QJYXFEJLRAEBGJ-XRIOVQLTSA-N |
| XLogP | 4.39 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane?
The IUPAC name of ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane (CID 177059114) is ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane.
What is the SMILES notation for ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane?
The canonical SMILES for ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane is C=C1CC[C@@](F)(C(N)=O)CC1(C)C.CC.CCC.
What is the InChIKey of ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane?
The InChIKey is QJYXFEJLRAEBGJ-XRIOVQLTSA-N. The full InChI is InChI=1S/C10H16FNO.C3H8.C2H6/c1-7-4-5-10(11,8(12)13)6-9(7,2)3;1-3-2;1-2/h1,4-6H2,2-3H3,(H2,12,13);3H2,1-2H3;1-2H3/t10-;;/m0../s1.
What are the key properties of ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane?
ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane has a molecular weight of 259.41 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1S)-1-fluoro-3,3-dimethyl-4-methylidenecyclohexane-1-carboxamide;propane is sourced from PubChem (CID 177059114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).