About 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one
1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one (PubChem CID 177059523) has the molecular formula C9H12FNO
and a molecular weight of 169.20 g/mol. Its IUPAC name is 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one.
Molecular Properties
| Compound Name | 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one |
| PubChem CID | 177059523 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)[C@]1(F)CNC(C)(C)C1 |
| InChI | InChI=1S/C9H12FNO/c1-4-7(12)9(10)5-8(2,3)11-6-9/h1,11H,5-6H2,2-3H3/t9-/m1/s1 |
| InChIKey | UXWIBTONCLNRMO-SECBINFHSA-N |
| XLogP | 0.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one?
The IUPAC name of 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one (CID 177059523) is 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one.
What is the SMILES notation for 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one?
The canonical SMILES for 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one is C#CC(=O)[C@]1(F)CNC(C)(C)C1.
What is the InChIKey of 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one?
The InChIKey is UXWIBTONCLNRMO-SECBINFHSA-N. The full InChI is InChI=1S/C9H12FNO/c1-4-7(12)9(10)5-8(2,3)11-6-9/h1,11H,5-6H2,2-3H3/t9-/m1/s1.
What are the key properties of 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one?
1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one has a molecular weight of 169.20 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3-fluoro-5,5-dimethylpyrrolidin-3-yl]prop-2-yn-1-one is sourced from PubChem (CID 177059523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).