C11H19NO — CID 177059693
1-[(3R)-2-methyl-2-azaspiro[4.4]nonan-3-yl]ethanone (PubChem CID 177059693) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-[(3R)-2-methyl-2-azaspiro[4.4]nonan-3-yl]ethanone.
| Compound Name | 1-[(3R)-2-methyl-2-azaspiro[4.4]nonan-3-yl]ethanone |
|---|---|
| PubChem CID | 177059693 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-[(3R)-2-methyl-2-azaspiro[4.4]nonan-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC2(CCCC2)CN1C |
| InChI | InChI=1S/C11H19NO/c1-9(13)10-7-11(8-12(10)2)5-3-4-6-11/h10H,3-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | QDRIMFKYOUFHQV-SNVBAGLBSA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |