About 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane
2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane (PubChem CID 177059751) has the molecular formula C27H39NO2
and a molecular weight of 409.61 g/mol. Its IUPAC name is 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane.
Molecular Properties
| Compound Name | 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane |
| PubChem CID | 177059751 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane |
| SMILES | CC.CNC(=O)C(C)(C)c1ccc(OC2CCCC2)c(-c2ccccc2C(C)C)c1 |
| InChI | InChI=1S/C25H33NO2.C2H6/c1-17(2)20-12-8-9-13-21(20)22-16-18(25(3,4)24(27)26-5)14-15-23(22)28-19-10-6-7-11-19;1-2/h8-9,12-17,19H,6-7,10-11H2,1-5H3,(H,26,27);1-2H3 |
| InChIKey | HSPFVBLNSFDEOX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane?
The IUPAC name of 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane (CID 177059751) is 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane.
What is the SMILES notation for 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane?
The canonical SMILES for 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane is CC.CNC(=O)C(C)(C)c1ccc(OC2CCCC2)c(-c2ccccc2C(C)C)c1.
What is the InChIKey of 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane?
The InChIKey is HSPFVBLNSFDEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO2.C2H6/c1-17(2)20-12-8-9-13-21(20)22-16-18(25(3,4)24(27)26-5)14-15-23(22)28-19-10-6-7-11-19;1-2/h8-9,12-17,19H,6-7,10-11H2,1-5H3,(H,26,27);1-2H3.
What are the key properties of 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane?
2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane has a molecular weight of 409.61 g/mol, XLogP of 6.85, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-cyclopentyloxy-3-(2-propan-2-ylphenyl)phenyl]-N,2-dimethylpropanamide;ethane is sourced from PubChem (CID 177059751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).