About 2-(1,4-dimethylpyrrol-3-yl)propanoic acid
2-(1,4-dimethylpyrrol-3-yl)propanoic acid (PubChem CID 177059756) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(1,4-dimethylpyrrol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-(1,4-dimethylpyrrol-3-yl)propanoic acid |
| PubChem CID | 177059756 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2-(1,4-dimethylpyrrol-3-yl)propanoic acid |
| SMILES | Cc1cn(C)cc1C(C)C(=O)O |
| InChI | InChI=1S/C9H13NO2/c1-6-4-10(3)5-8(6)7(2)9(11)12/h4-5,7H,1-3H3,(H,11,12) |
| InChIKey | ARNNIMXBZRGARQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,4-dimethylpyrrol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dimethylpyrrol-3-yl)propanoic acid?
The IUPAC name of 2-(1,4-dimethylpyrrol-3-yl)propanoic acid (CID 177059756) is 2-(1,4-dimethylpyrrol-3-yl)propanoic acid.
What is the SMILES notation for 2-(1,4-dimethylpyrrol-3-yl)propanoic acid?
The canonical SMILES for 2-(1,4-dimethylpyrrol-3-yl)propanoic acid is Cc1cn(C)cc1C(C)C(=O)O.
What is the InChIKey of 2-(1,4-dimethylpyrrol-3-yl)propanoic acid?
The InChIKey is ARNNIMXBZRGARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-6-4-10(3)5-8(6)7(2)9(11)12/h4-5,7H,1-3H3,(H,11,12).
What are the key properties of 2-(1,4-dimethylpyrrol-3-yl)propanoic acid?
2-(1,4-dimethylpyrrol-3-yl)propanoic acid has a molecular weight of 167.21 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dimethylpyrrol-3-yl)propanoic acid is sourced from PubChem (CID 177059756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).