C17H23F4N3 — CID 177059913
5-fluoro-5-methyl-2-[6-methyl-2-(trifluoromethyl)pyrimidin-4-yl]-2-azaspiro[5.5]undecane (PubChem CID 177059913) has the molecular formula C17H23F4N3 and a molecular weight of 345.38 g/mol. Its IUPAC name is 5-fluoro-5-methyl-2-[6-methyl-2-(trifluoromethyl)pyrimidin-4-yl]-2-azaspiro[5.5]undecane.
| Compound Name | 5-fluoro-5-methyl-2-[6-methyl-2-(trifluoromethyl)pyrimidin-4-yl]-2-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 177059913 |
| Molecular Formula | C17H23F4N3 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 5-fluoro-5-methyl-2-[6-methyl-2-(trifluoromethyl)pyrimidin-4-yl]-2-azaspiro[5.5]undecane |
| SMILES | Cc1cc(N2CCC(C)(F)C3(CCCCC3)C2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H23F4N3/c1-12-10-13(23-14(22-12)17(19,20)21)24-9-8-15(2,18)16(11-24)6-4-3-5-7-16/h10H,3-9,11H2,1-2H3 |
| InChIKey | KMWMZMZCVQSTKG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |