About ethane;2-ethyl-5-methyloxolane-2,3-diol
ethane;2-ethyl-5-methyloxolane-2,3-diol (PubChem CID 177060039) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;2-ethyl-5-methyloxolane-2,3-diol.
Molecular Properties
| Compound Name | ethane;2-ethyl-5-methyloxolane-2,3-diol |
| PubChem CID | 177060039 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | ethane;2-ethyl-5-methyloxolane-2,3-diol |
| SMILES | CC.CCC1(O)OC(C)CC1O |
| InChI | InChI=1S/C7H14O3.C2H6/c1-3-7(9)6(8)4-5(2)10-7;1-2/h5-6,8-9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | JYMZLLQFIQOFSN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-ethyl-5-methyloxolane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-5-methyloxolane-2,3-diol?
The IUPAC name of ethane;2-ethyl-5-methyloxolane-2,3-diol (CID 177060039) is ethane;2-ethyl-5-methyloxolane-2,3-diol.
What is the SMILES notation for ethane;2-ethyl-5-methyloxolane-2,3-diol?
The canonical SMILES for ethane;2-ethyl-5-methyloxolane-2,3-diol is CC.CCC1(O)OC(C)CC1O.
What is the InChIKey of ethane;2-ethyl-5-methyloxolane-2,3-diol?
The InChIKey is JYMZLLQFIQOFSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C2H6/c1-3-7(9)6(8)4-5(2)10-7;1-2/h5-6,8-9H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethyl-5-methyloxolane-2,3-diol?
ethane;2-ethyl-5-methyloxolane-2,3-diol has a molecular weight of 176.26 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-5-methyloxolane-2,3-diol is sourced from PubChem (CID 177060039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).