C22H14F2N2O3S — CID 177060184
3-(5-fluoro-1-benzothiophen-3-yl)-4-(6-fluoro-5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 177060184) has the molecular formula C22H14F2N2O3S and a molecular weight of 424.43 g/mol. Its IUPAC name is 3-(5-fluoro-1-benzothiophen-3-yl)-4-(6-fluoro-5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(5-fluoro-1-benzothiophen-3-yl)-4-(6-fluoro-5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 177060184 |
| Molecular Formula | C22H14F2N2O3S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3-(5-fluoro-1-benzothiophen-3-yl)-4-(6-fluoro-5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1cc2c(C3=C(c4csc5ccc(F)cc45)C(=O)NC3=O)cn(C)c2cc1F |
| InChI | InChI=1S/C22H14F2N2O3S/c1-26-8-13(11-6-17(29-2)15(24)7-16(11)26)19-20(22(28)25-21(19)27)14-9-30-18-4-3-10(23)5-12(14)18/h3-9H,1-2H3,(H,25,27,28) |
| InChIKey | WMOXONLJMJEIOV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|