About 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane
1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane (PubChem CID 177060831) has the molecular formula C18H41NO5
and a molecular weight of 351.53 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane.
Molecular Properties
| Compound Name | 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane |
| PubChem CID | 177060831 |
| Molecular Formula | C18H41NO5 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane |
| SMILES | CC.CCC.CCC(=O)CCOCCOCCOCCOCCN |
| InChI | InChI=1S/C13H27NO5.C3H8.C2H6/c1-2-13(15)3-5-16-7-9-18-11-12-19-10-8-17-6-4-14;1-3-2;1-2/h2-12,14H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | CZXAWGSOEVIVDO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane?
The IUPAC name of 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane (CID 177060831) is 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane.
What is the SMILES notation for 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane?
The canonical SMILES for 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane is CC.CCC.CCC(=O)CCOCCOCCOCCOCCN.
What is the InChIKey of 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane?
The InChIKey is CZXAWGSOEVIVDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO5.C3H8.C2H6/c1-2-13(15)3-5-16-7-9-18-11-12-19-10-8-17-6-4-14;1-3-2;1-2/h2-12,14H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane?
1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane has a molecular weight of 351.53 g/mol, XLogP of 2.82, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]pentan-3-one;ethane;propane is sourced from PubChem (CID 177060831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).