About 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene
1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene (PubChem CID 177061034) has the molecular formula C18H26F2
and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene |
| PubChem CID | 177061034 |
| Molecular Formula | C18H26F2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene |
| SMILES | C/C(F)=C/C(C)CC(C)(C)c1ccc(C(C)(C)F)cc1 |
| InChI | InChI=1S/C18H26F2/c1-13(11-14(2)19)12-17(3,4)15-7-9-16(10-8-15)18(5,6)20/h7-11,13H,12H2,1-6H3/b14-11- |
| InChIKey | IOMDNZXBTMJAHR-KAMYIIQDSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene?
The IUPAC name of 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene (CID 177061034) is 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene.
What is the SMILES notation for 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene?
The canonical SMILES for 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene is C/C(F)=C/C(C)CC(C)(C)c1ccc(C(C)(C)F)cc1.
What is the InChIKey of 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene?
The InChIKey is IOMDNZXBTMJAHR-KAMYIIQDSA-N. The full InChI is InChI=1S/C18H26F2/c1-13(11-14(2)19)12-17(3,4)15-7-9-16(10-8-15)18(5,6)20/h7-11,13H,12H2,1-6H3/b14-11-.
What are the key properties of 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene?
1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene has a molecular weight of 280.40 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-6-fluoro-2,4-dimethylhept-5-en-2-yl]-4-(2-fluoropropan-2-yl)benzene is sourced from PubChem (CID 177061034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).