About 2-methyl-4-propyl-7,8-dihydroquinazoline
2-methyl-4-propyl-7,8-dihydroquinazoline (PubChem CID 177061424) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-methyl-4-propyl-7,8-dihydroquinazoline.
Molecular Properties
| Compound Name | 2-methyl-4-propyl-7,8-dihydroquinazoline |
| PubChem CID | 177061424 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-methyl-4-propyl-7,8-dihydroquinazoline |
| SMILES | CCCc1nc(C)nc2c1C=CCC2 |
| InChI | InChI=1S/C12H16N2/c1-3-6-11-10-7-4-5-8-12(10)14-9(2)13-11/h4,7H,3,5-6,8H2,1-2H3 |
| InChIKey | SRYSZSRMMQOFCY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-propyl-7,8-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-propyl-7,8-dihydroquinazoline?
The IUPAC name of 2-methyl-4-propyl-7,8-dihydroquinazoline (CID 177061424) is 2-methyl-4-propyl-7,8-dihydroquinazoline.
What is the SMILES notation for 2-methyl-4-propyl-7,8-dihydroquinazoline?
The canonical SMILES for 2-methyl-4-propyl-7,8-dihydroquinazoline is CCCc1nc(C)nc2c1C=CCC2.
What is the InChIKey of 2-methyl-4-propyl-7,8-dihydroquinazoline?
The InChIKey is SRYSZSRMMQOFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-3-6-11-10-7-4-5-8-12(10)14-9(2)13-11/h4,7H,3,5-6,8H2,1-2H3.
What are the key properties of 2-methyl-4-propyl-7,8-dihydroquinazoline?
2-methyl-4-propyl-7,8-dihydroquinazoline has a molecular weight of 188.27 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-propyl-7,8-dihydroquinazoline is sourced from PubChem (CID 177061424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).