C18H27N3 — CID 177061440
2-ethanimidoyl-N-methyl-5-(1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl)aniline (PubChem CID 177061440) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-ethanimidoyl-N-methyl-5-(1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl)aniline.
| Compound Name | 2-ethanimidoyl-N-methyl-5-(1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl)aniline |
|---|---|
| PubChem CID | 177061440 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-ethanimidoyl-N-methyl-5-(1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl)aniline |
| SMILES | [H]/N=C(\C)c1ccc(C23CCCCC2N(C)CC3)cc1NC |
| InChI | InChI=1S/C18H27N3/c1-13(19)15-8-7-14(12-16(15)20-2)18-9-5-4-6-17(18)21(3)11-10-18/h7-8,12,17,19-20H,4-6,9-11H2,1-3H3/b19-13+ |
| InChIKey | CZEDRUAPUYGXHF-CPNJWEJPSA-N |
| XLogP | 3.63 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|