C20H22Cl2N4O4S — CID 177062027
1-[2-[2-(2-aminoethoxy)ethoxy]acetyl]-N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2,5-dihydropyrrole-3-carboxamide (PubChem CID 177062027) has the molecular formula C20H22Cl2N4O4S and a molecular weight of 485.39 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethoxy)ethoxy]acetyl]-N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2,5-dihydropyrrole-3-carboxamide.
| Compound Name | 1-[2-[2-(2-aminoethoxy)ethoxy]acetyl]-N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2,5-dihydropyrrole-3-carboxamide |
|---|---|
| PubChem CID | 177062027 |
| Molecular Formula | C20H22Cl2N4O4S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 1-[2-[2-(2-aminoethoxy)ethoxy]acetyl]-N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2,5-dihydropyrrole-3-carboxamide |
| SMILES | NCCOCCOCC(=O)N1CC=C(C(=O)Nc2csc(-c3ccc(Cl)c(Cl)c3)n2)C1 |
| InChI | InChI=1S/C20H22Cl2N4O4S/c21-15-2-1-13(9-16(15)22)20-25-17(12-31-20)24-19(28)14-3-5-26(10-14)18(27)11-30-8-7-29-6-4-23/h1-3,9,12H,4-8,10-11,23H2,(H,24,28) |
| InChIKey | IEFURMQWRKWMOG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|