C18H30N2O — CID 177062047
(6Z)-6-[amino-(1-ethylpiperidin-4-yl)methylidene]cyclohexa-2,3,4-trien-1-one;ethane (PubChem CID 177062047) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (6Z)-6-[amino-(1-ethylpiperidin-4-yl)methylidene]cyclohexa-2,3,4-trien-1-one;ethane.
| Compound Name | (6Z)-6-[amino-(1-ethylpiperidin-4-yl)methylidene]cyclohexa-2,3,4-trien-1-one;ethane |
|---|---|
| PubChem CID | 177062047 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (6Z)-6-[amino-(1-ethylpiperidin-4-yl)methylidene]cyclohexa-2,3,4-trien-1-one;ethane |
| SMILES | CC.CC.CCN1CCC(/C(N)=C2\C=C=C=CC2=O)CC1 |
| InChI | InChI=1S/C14H18N2O.2C2H6/c1-2-16-9-7-11(8-10-16)14(15)12-5-3-4-6-13(12)17;2*1-2/h5-6,11H,2,7-10,15H2,1H3;2*1-2H3/b14-12-;; |
| InChIKey | IWJVUSZPOICETM-NEKXZPCZSA-N |
| XLogP | 3.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|