About N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine
N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine (PubChem CID 177062188) has the molecular formula C14H15Cl2N3OS
and a molecular weight of 344.27 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine.
Molecular Properties
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine |
| PubChem CID | 177062188 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine |
| SMILES | C1CCNC1.O=CNc1csc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C10H6Cl2N2OS.C4H9N/c11-7-2-1-6(3-8(7)12)10-14-9(4-16-10)13-5-15;1-2-4-5-3-1/h1-5H,(H,13,15);5H,1-4H2 |
| InChIKey | BNZXNUQNEOSUEG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine?
The IUPAC name of N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine (CID 177062188) is N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine.
What is the SMILES notation for N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine?
The canonical SMILES for N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine is C1CCNC1.O=CNc1csc(-c2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine?
The InChIKey is BNZXNUQNEOSUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2OS.C4H9N/c11-7-2-1-6(3-8(7)12)10-14-9(4-16-10)13-5-15;1-2-4-5-3-1/h1-5H,(H,13,15);5H,1-4H2.
What are the key properties of N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine?
N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine has a molecular weight of 344.27 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine is sourced from PubChem (CID 177062188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).