C14H15Cl2N3OS — CID 177062188
N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine (PubChem CID 177062188) has the molecular formula C14H15Cl2N3OS and a molecular weight of 344.27 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine |
|---|---|
| PubChem CID | 177062188 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]formamide;pyrrolidine |
| SMILES | C1CCNC1.O=CNc1csc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C10H6Cl2N2OS.C4H9N/c11-7-2-1-6(3-8(7)12)10-14-9(4-16-10)13-5-15;1-2-4-5-3-1/h1-5H,(H,13,15);5H,1-4H2 |
| InChIKey | BNZXNUQNEOSUEG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|