About acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate
acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate (PubChem CID 177062934) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate.
Molecular Properties
| Compound Name | acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate |
| PubChem CID | 177062934 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate |
| SMILES | C#C.CC(N)=O.COC(=O)CCSO |
| InChI | InChI=1S/C4H8O3S.C2H5NO.C2H2/c1-7-4(5)2-3-8-6;1-2(3)4;1-2/h6H,2-3H2,1H3;1H3,(H2,3,4);1-2H |
| InChIKey | LRNASPUDAXIDCM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate?
The IUPAC name of acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate (CID 177062934) is acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate.
What is the SMILES notation for acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate?
The canonical SMILES for acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate is C#C.CC(N)=O.COC(=O)CCSO.
What is the InChIKey of acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate?
The InChIKey is LRNASPUDAXIDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3S.C2H5NO.C2H2/c1-7-4(5)2-3-8-6;1-2(3)4;1-2/h6H,2-3H2,1H3;1H3,(H2,3,4);1-2H.
What are the key properties of acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate?
acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate has a molecular weight of 221.28 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;acetylene;methyl 3-hydroxysulfanylpropanoate is sourced from PubChem (CID 177062934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).