About acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate
acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate (PubChem CID 177062947) has the molecular formula C9H18N2O4S
and a molecular weight of 250.32 g/mol. Its IUPAC name is acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate.
Molecular Properties
| Compound Name | acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate |
| PubChem CID | 177062947 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate |
| SMILES | CC(N)=O.CCCOC(=O)C(C)CSN=O |
| InChI | InChI=1S/C7H13NO3S.C2H5NO/c1-3-4-11-7(9)6(2)5-12-8-10;1-2(3)4/h6H,3-5H2,1-2H3;1H3,(H2,3,4) |
| InChIKey | ZFWDDERDTYODKM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate?
The IUPAC name of acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate (CID 177062947) is acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate.
What is the SMILES notation for acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate?
The canonical SMILES for acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate is CC(N)=O.CCCOC(=O)C(C)CSN=O.
What is the InChIKey of acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate?
The InChIKey is ZFWDDERDTYODKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3S.C2H5NO/c1-3-4-11-7(9)6(2)5-12-8-10;1-2(3)4/h6H,3-5H2,1-2H3;1H3,(H2,3,4).
What are the key properties of acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate?
acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate has a molecular weight of 250.32 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;propyl 2-methyl-3-nitrososulfanylpropanoate is sourced from PubChem (CID 177062947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).