C14H19F3N2O4 — CID 177063030
methyl 2-[3-(2-hydroxyethyl)-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-methylpentanoate (PubChem CID 177063030) has the molecular formula C14H19F3N2O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is methyl 2-[3-(2-hydroxyethyl)-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-methylpentanoate.
| Compound Name | methyl 2-[3-(2-hydroxyethyl)-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 177063030 |
| Molecular Formula | C14H19F3N2O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | methyl 2-[3-(2-hydroxyethyl)-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)n1nc(CCO)c(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C14H19F3N2O4/c1-8(2)6-11(13(22)23-3)19-12(21)7-9(14(15,16)17)10(18-19)4-5-20/h7-8,11,20H,4-6H2,1-3H3 |
| InChIKey | RJZWHVWWQAYAJT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |