About 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide
2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide (PubChem CID 177063257) has the molecular formula C12H18BrN3O
and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide.
Molecular Properties
| Compound Name | 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide |
| PubChem CID | 177063257 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide |
| SMILES | Br.Cn1cc2c(n1)C(=O)CC1(CCNCC1)C2 |
| InChI | InChI=1S/C12H17N3O.BrH/c1-15-8-9-6-12(2-4-13-5-3-12)7-10(16)11(9)14-15;/h8,13H,2-7H2,1H3;1H |
| InChIKey | XQSRPSGCXWNZBV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide?
The IUPAC name of 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide (CID 177063257) is 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide.
What is the SMILES notation for 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide?
The canonical SMILES for 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide is Br.Cn1cc2c(n1)C(=O)CC1(CCNCC1)C2.
What is the InChIKey of 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide?
The InChIKey is XQSRPSGCXWNZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O.BrH/c1-15-8-9-6-12(2-4-13-5-3-12)7-10(16)11(9)14-15;/h8,13H,2-7H2,1H3;1H.
What are the key properties of 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide?
2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide has a molecular weight of 300.20 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one;hydrobromide is sourced from PubChem (CID 177063257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).