C19H17BrClFN2OS — CID 177064355
1-[2-(4-bromo-2-fluoro-6-methylphenyl)-7-chloroimidazo[1,2-a]pyridin-3-yl]-3-(dimethyl-λ4-sulfanylidene)propan-2-one (PubChem CID 177064355) has the molecular formula C19H17BrClFN2OS and a molecular weight of 455.78 g/mol. Its IUPAC name is 1-[2-(4-bromo-2-fluoro-6-methylphenyl)-7-chloroimidazo[1,2-a]pyridin-3-yl]-3-(dimethyl-λ4-sulfanylidene)propan-2-one.
| Compound Name | 1-[2-(4-bromo-2-fluoro-6-methylphenyl)-7-chloroimidazo[1,2-a]pyridin-3-yl]-3-(dimethyl-λ4-sulfanylidene)propan-2-one |
|---|---|
| PubChem CID | 177064355 |
| Molecular Formula | C19H17BrClFN2OS |
| Molecular Weight | 455.78 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 1-[2-(4-bromo-2-fluoro-6-methylphenyl)-7-chloroimidazo[1,2-a]pyridin-3-yl]-3-(dimethyl-λ4-sulfanylidene)propan-2-one |
| SMILES | Cc1cc(Br)cc(F)c1-c1nc2cc(Cl)ccn2c1CC(=O)C=S(C)C |
| InChI | InChI=1S/C19H17BrClFN2OS/c1-11-6-12(20)7-15(22)18(11)19-16(9-14(25)10-26(2)3)24-5-4-13(21)8-17(24)23-19/h4-8,10H,9H2,1-3H3 |
| InChIKey | BUWNMZZAKXNWCN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|