C19H15F5N2O2 — CID 177064817
5-methyl-4-[(2E)-3-methyl-2-prop-1-en-2-ylpenta-2,4-dienoyl]-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one (PubChem CID 177064817) has the molecular formula C19H15F5N2O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 5-methyl-4-[(2E)-3-methyl-2-prop-1-en-2-ylpenta-2,4-dienoyl]-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[(2E)-3-methyl-2-prop-1-en-2-ylpenta-2,4-dienoyl]-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 177064817 |
| Molecular Formula | C19H15F5N2O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 5-methyl-4-[(2E)-3-methyl-2-prop-1-en-2-ylpenta-2,4-dienoyl]-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one |
| SMILES | C=C/C(C)=C(\C(=C)C)C(=O)c1c(C)[nH]n(-c2c(F)c(F)c(F)c(F)c2F)c1=O |
| InChI | InChI=1S/C19H15F5N2O2/c1-6-8(4)10(7(2)3)18(27)11-9(5)25-26(19(11)28)17-15(23)13(21)12(20)14(22)16(17)24/h6,25H,1-2H2,3-5H3/b10-8+ |
| InChIKey | PHBVSKCMIUYUGM-CSKARUKUSA-N |
| XLogP | 4.43 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|