About 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate
4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate (PubChem CID 177065019) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate.
Molecular Properties
| Compound Name | 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate |
| PubChem CID | 177065019 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate |
| SMILES | CC1=NN(c2ccccc2)C(O)C1C(C)O.O |
| InChI | InChI=1S/C12H16N2O2.H2O/c1-8-11(9(2)15)12(16)14(13-8)10-6-4-3-5-7-10;/h3-7,9,11-12,15-16H,1-2H3;1H2 |
| InChIKey | RVWBSYNNLLDMMK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate?
The IUPAC name of 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate (CID 177065019) is 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate.
What is the SMILES notation for 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate?
The canonical SMILES for 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate is CC1=NN(c2ccccc2)C(O)C1C(C)O.O.
What is the InChIKey of 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate?
The InChIKey is RVWBSYNNLLDMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2.H2O/c1-8-11(9(2)15)12(16)14(13-8)10-6-4-3-5-7-10;/h3-7,9,11-12,15-16H,1-2H3;1H2.
What are the key properties of 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate?
4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate has a molecular weight of 238.29 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-hydroxyethyl)-5-methyl-2-phenyl-3,4-dihydropyrazol-3-ol;hydrate is sourced from PubChem (CID 177065019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).