C14H10F6N2O3 — CID 177065078
4-[4-(3,3-difluoro-2-methoxypropyl)-5-hydroxy-4,5-dihydro-1,3-oxazol-2-yl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 177065078) has the molecular formula C14H10F6N2O3 and a molecular weight of 368.23 g/mol. Its IUPAC name is 4-[4-(3,3-difluoro-2-methoxypropyl)-5-hydroxy-4,5-dihydro-1,3-oxazol-2-yl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[4-(3,3-difluoro-2-methoxypropyl)-5-hydroxy-4,5-dihydro-1,3-oxazol-2-yl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 177065078 |
| Molecular Formula | C14H10F6N2O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-[4-(3,3-difluoro-2-methoxypropyl)-5-hydroxy-4,5-dihydro-1,3-oxazol-2-yl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | COC(CC1N=C(c2c(F)c(F)c(C#N)c(F)c2F)OC1O)C(F)F |
| InChI | InChI=1S/C14H10F6N2O3/c1-24-6(12(19)20)2-5-14(23)25-13(22-5)7-10(17)8(15)4(3-21)9(16)11(7)18/h5-6,12,14,23H,2H2,1H3 |
| InChIKey | OSRQUDMXYSRLGZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|