C16H20F7NO4 — CID 177065079
ethane;methanol;2-(2,3,5,6-tetrafluorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-5,6-dihydro-4H-1,3-oxazin-6-ol (PubChem CID 177065079) has the molecular formula C16H20F7NO4 and a molecular weight of 423.33 g/mol. Its IUPAC name is ethane;methanol;2-(2,3,5,6-tetrafluorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-5,6-dihydro-4H-1,3-oxazin-6-ol.
| Compound Name | ethane;methanol;2-(2,3,5,6-tetrafluorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-5,6-dihydro-4H-1,3-oxazin-6-ol |
|---|---|
| PubChem CID | 177065079 |
| Molecular Formula | C16H20F7NO4 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | ethane;methanol;2-(2,3,5,6-tetrafluorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-5,6-dihydro-4H-1,3-oxazin-6-ol |
| SMILES | CC.CO.OC1CC(CC(O)C(F)(F)F)N=C(c2c(F)c(F)cc(F)c2F)O1 |
| InChI | InChI=1S/C13H10F7NO3.C2H6.CH4O/c14-5-3-6(15)11(17)9(10(5)16)12-21-4(2-8(23)24-12)1-7(22)13(18,19)20;2*1-2/h3-4,7-8,22-23H,1-2H2;1-2H3;2H,1H3 |
| InChIKey | YRKLUAFTIRFPMI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|