C31H24EuF3N3O3 — CID 177066142
4,7-dimethyl-1,10-phenanthroline;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium (PubChem CID 177066142) has the molecular formula C31H24EuF3N3O3 and a molecular weight of 695.51 g/mol. Its IUPAC name is 4,7-dimethyl-1,10-phenanthroline;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium.
| Compound Name | 4,7-dimethyl-1,10-phenanthroline;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium |
|---|---|
| PubChem CID | 177066142 |
| Molecular Formula | C31H24EuF3N3O3 |
| Molecular Weight | 695.51 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | 4,7-dimethyl-1,10-phenanthroline;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium |
| SMILES | CCn1c(=O)c(C(=O)C(F)(F)F)c(O)c2ccc3ccccc3c21.Cc1ccnc2c1ccc1c(C)ccnc12.[Eu] |
| InChI | InChI=1S/C17H12F3NO3.C14H12N2.Eu/c1-2-21-13-10-6-4-3-5-9(10)7-8-11(13)14(22)12(16(21)24)15(23)17(18,19)20;1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13;/h3-8,22H,2H2,1H3;3-8H,1-2H3; |
| InChIKey | BCJZMGDWEFXKIX-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.51 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|