C31H23EuF3N2O4 — CID 177066256
europium;1-hydroxy-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one;2,3,8,9-tetramethyl-1,10-phenanthroline (PubChem CID 177066256) has the molecular formula C31H23EuF3N2O4 and a molecular weight of 696.49 g/mol. Its IUPAC name is europium;1-hydroxy-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one;2,3,8,9-tetramethyl-1,10-phenanthroline.
| Compound Name | europium;1-hydroxy-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one;2,3,8,9-tetramethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 177066256 |
| Molecular Formula | C31H23EuF3N2O4 |
| Molecular Weight | 696.49 g/mol |
| Exact Mass | 697.08 |
| IUPAC Name | europium;1-hydroxy-2-(2,2,2-trifluoroacetyl)benzo[f]chromen-3-one;2,3,8,9-tetramethyl-1,10-phenanthroline |
| SMILES | Cc1cc2ccc3cc(C)c(C)nc3c2nc1C.O=C(c1c(O)c2c(ccc3ccccc32)oc1=O)C(F)(F)F.[Eu] |
| InChI | InChI=1S/C16H16N2.C15H7F3O4.Eu/c1-9-7-13-5-6-14-8-10(2)12(4)18-16(14)15(13)17-11(9)3;16-15(17,18)13(20)11-12(19)10-8-4-2-1-3-7(8)5-6-9(10)22-14(11)21;/h5-8H,1-4H3;1-6,19H; |
| InChIKey | DXGYLORJUPNQOD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.49 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|