C23H13EuF3N2O4 — CID 177066262
europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline (PubChem CID 177066262) has the molecular formula C23H13EuF3N2O4 and a molecular weight of 590.33 g/mol. Its IUPAC name is europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline.
| Compound Name | europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline |
|---|---|
| PubChem CID | 177066262 |
| Molecular Formula | C23H13EuF3N2O4 |
| Molecular Weight | 590.33 g/mol |
| Exact Mass | 591.00 |
| IUPAC Name | europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline |
| SMILES | O=C(c1c(O)c2ccccc2oc1=O)C(F)(F)F.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C11H5F3O4.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;12-11(13,14)9(16)7-8(15)5-3-1-2-4-6(5)18-10(7)17;/h1-8H;1-4,15H; |
| InChIKey | SLQHPKLYIQRUKQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|