C29H19EuF3N2O4 — CID 177066449
5,6-dimethyl-1,10-phenanthroline;europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-2-one (PubChem CID 177066449) has the molecular formula C29H19EuF3N2O4 and a molecular weight of 668.44 g/mol. Its IUPAC name is 5,6-dimethyl-1,10-phenanthroline;europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-2-one.
| Compound Name | 5,6-dimethyl-1,10-phenanthroline;europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-2-one |
|---|---|
| PubChem CID | 177066449 |
| Molecular Formula | C29H19EuF3N2O4 |
| Molecular Weight | 668.44 g/mol |
| Exact Mass | 669.05 |
| IUPAC Name | 5,6-dimethyl-1,10-phenanthroline;europium;4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-2-one |
| SMILES | Cc1c(C)c2cccnc2c2ncccc12.O=C(c1c(O)c2ccc3ccccc3c2oc1=O)C(F)(F)F.[Eu] |
| InChI | InChI=1S/C15H7F3O4.C14H12N2.Eu/c16-15(17,18)13(20)10-11(19)9-6-5-7-3-1-2-4-8(7)12(9)22-14(10)21;1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13;/h1-6,19H;3-8H,1-2H3; |
| InChIKey | IMKCAKFXOGEZBJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.44 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|