C27H44O3Si — CID 177067633
3-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylcyclohexa-2,5-diene-1,4-dione (PubChem CID 177067633) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 177067633 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCC1=CC(=O)C(C/C=C(\C)CCC=C(C)C)=C(O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C27H44O3Si/c1-10-11-12-16-22-19-24(28)23(18-17-21(4)15-13-14-20(2)3)26(25(22)29)30-31(8,9)27(5,6)7/h14,17,19H,10-13,15-16,18H2,1-9H3/b21-17+ |
| InChIKey | HZJLWWFLQRHORR-HEHNFIMWSA-N |
| XLogP | 8.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|