C24H36O4 — CID 177067646
[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-4-oxo-5-pentylcyclohexa-2,5-dien-1-yl] propanoate (PubChem CID 177067646) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-4-oxo-5-pentylcyclohexa-2,5-dien-1-yl] propanoate.
| Compound Name | [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-4-oxo-5-pentylcyclohexa-2,5-dien-1-yl] propanoate |
|---|---|
| PubChem CID | 177067646 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-4-oxo-5-pentylcyclohexa-2,5-dien-1-yl] propanoate |
| SMILES | CCCCCC1=CC(OC(=O)CC)C(C/C=C(\C)CCC=C(C)C)=C(O)C1=O |
| InChI | InChI=1S/C24H36O4/c1-6-8-9-13-19-16-21(28-22(25)7-2)20(24(27)23(19)26)15-14-18(5)12-10-11-17(3)4/h11,14,16,21,27H,6-10,12-13,15H2,1-5H3/b18-14+ |
| InChIKey | LKXKLJIVHXYBEN-NBVRZTHBSA-N |
| XLogP | 6.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|