C54H45N — CID 177067780
8-tert-butyl-6-methyl-9,9-diphenyl-N,N-bis(4-phenylphenyl)fluoren-3-amine (PubChem CID 177067780) has the molecular formula C54H45N and a molecular weight of 707.96 g/mol. Its IUPAC name is 8-tert-butyl-6-methyl-9,9-diphenyl-N,N-bis(4-phenylphenyl)fluoren-3-amine.
| Compound Name | 8-tert-butyl-6-methyl-9,9-diphenyl-N,N-bis(4-phenylphenyl)fluoren-3-amine |
|---|---|
| PubChem CID | 177067780 |
| Molecular Formula | C54H45N |
| Molecular Weight | 707.96 g/mol |
| Exact Mass | 707.36 |
| IUPAC Name | 8-tert-butyl-6-methyl-9,9-diphenyl-N,N-bis(4-phenylphenyl)fluoren-3-amine |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)C(c1ccccc1)(c1ccccc1)c1ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc1-2 |
| InChI | InChI=1S/C54H45N/c1-38-35-49-48-37-47(33-34-50(48)54(43-21-13-7-14-22-43,44-23-15-8-16-24-44)52(49)51(36-38)53(2,3)4)55(45-29-25-41(26-30-45)39-17-9-5-10-18-39)46-31-27-42(28-32-46)40-19-11-6-12-20-40/h5-37H,1-4H3 |
| InChIKey | PBZCXLXBKLYHKA-UHFFFAOYSA-N |
| XLogP | 14.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.96 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |