About 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate
5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate (PubChem CID 177068593) has the molecular formula C16H15N3O6
and a molecular weight of 345.31 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate |
| PubChem CID | 177068593 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate |
| SMILES | [C-]#[N+]c1ccc(N2CC(O)=C(C(=O)OCC)C(=O)N2C(=O)OC)cc1 |
| InChI | InChI=1S/C16H15N3O6/c1-4-25-15(22)13-12(20)9-18(19(14(13)21)16(23)24-3)11-7-5-10(17-2)6-8-11/h5-8,20H,4,9H2,1,3H3 |
| InChIKey | POGHHVHXFPPBGO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate?
The IUPAC name of 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate (CID 177068593) is 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate?
The canonical SMILES for 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate is [C-]#[N+]c1ccc(N2CC(O)=C(C(=O)OCC)C(=O)N2C(=O)OC)cc1.
What is the InChIKey of 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate?
The InChIKey is POGHHVHXFPPBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O6/c1-4-25-15(22)13-12(20)9-18(19(14(13)21)16(23)24-3)11-7-5-10(17-2)6-8-11/h5-8,20H,4,9H2,1,3H3.
What are the key properties of 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate?
5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate has a molecular weight of 345.31 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl 4-hydroxy-2-(4-isocyanophenyl)-6-oxo-3H-pyridazine-1,5-dicarboxylate is sourced from PubChem (CID 177068593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).