C13H21N5O2 — CID 177068671
(3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2,2-dideuterio-2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylic acid (PubChem CID 177068671) has the molecular formula C13H21N5O2 and a molecular weight of 284.37 g/mol. Its IUPAC name is (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2,2-dideuterio-2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylic acid.
| Compound Name | (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2,2-dideuterio-2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 177068671 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2,2-dideuterio-2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylic acid |
| SMILES | [2H]C([2H])(C[C@H]1CC[C@@H]2[C@H](C1)C[C@@]([2H])(C(=O)O)NC2([2H])[2H])c1nn[nH]n1 |
| InChI | InChI=1S/C13H21N5O2/c19-13(20)11-6-10-5-8(1-3-9(10)7-14-11)2-4-12-15-17-18-16-12/h8-11,14H,1-7H2,(H,19,20)(H,15,16,17,18)/t8-,9+,10-,11+/m1/s1/i4D2,7D2,11D |
| InChIKey | ZXFRFPSZAKNPQQ-FBFBIGRKSA-N |
| XLogP | 0.61 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |