C14H20N5P3 — CID 177068903
[12-[(4S)-4-ethyl-1-phosphanylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]-phosphanylphosphane (PubChem CID 177068903) has the molecular formula C14H20N5P3 and a molecular weight of 351.27 g/mol. Its IUPAC name is [12-[(4S)-4-ethyl-1-phosphanylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]-phosphanylphosphane.
| Compound Name | [12-[(4S)-4-ethyl-1-phosphanylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]-phosphanylphosphane |
|---|---|
| PubChem CID | 177068903 |
| Molecular Formula | C14H20N5P3 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [12-[(4S)-4-ethyl-1-phosphanylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]-phosphanylphosphane |
| SMILES | CC[C@@H]1CN(P)CC1c1cnc2cnc3c(ccn3PP)n12 |
| InChI | InChI=1S/C14H20N5P3/c1-2-9-7-17(20)8-10(9)12-5-15-13-6-16-14-11(19(12)13)3-4-18(14)22-21/h3-6,9-10,22H,2,7-8,20-21H2,1H3/t9-,10?/m1/s1 |
| InChIKey | GPIHJPRBTJLVFU-YHMJZVADSA-N |
| XLogP | 3.13 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|