C11H17F3O5S2 — CID 177070516
1,1,2-trifluoro-3-methyl-4-(thiolane-2-carbonyloxy)pentane-1-sulfonic acid (PubChem CID 177070516) has the molecular formula C11H17F3O5S2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-methyl-4-(thiolane-2-carbonyloxy)pentane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-3-methyl-4-(thiolane-2-carbonyloxy)pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 177070516 |
| Molecular Formula | C11H17F3O5S2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1,1,2-trifluoro-3-methyl-4-(thiolane-2-carbonyloxy)pentane-1-sulfonic acid |
| SMILES | CC(OC(=O)C1CCCS1)C(C)C(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H17F3O5S2/c1-6(9(12)11(13,14)21(16,17)18)7(2)19-10(15)8-4-3-5-20-8/h6-9H,3-5H2,1-2H3,(H,16,17,18) |
| InChIKey | YBOLISYIOFAZNF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|