C21H18N2O4S — CID 177070569
2-[(4,5-dioxonaphtho[1,2-g][1,3]benzothiazol-2-yl)amino]-4-methylpentanoic acid (PubChem CID 177070569) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[(4,5-dioxonaphtho[1,2-g][1,3]benzothiazol-2-yl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[(4,5-dioxonaphtho[1,2-g][1,3]benzothiazol-2-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 177070569 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-[(4,5-dioxonaphtho[1,2-g][1,3]benzothiazol-2-yl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(Nc1nc2ccc3c(c2s1)C(=O)C(=O)c1ccccc1-3)C(=O)O |
| InChI | InChI=1S/C21H18N2O4S/c1-10(2)9-15(20(26)27)23-21-22-14-8-7-12-11-5-3-4-6-13(11)17(24)18(25)16(12)19(14)28-21/h3-8,10,15H,9H2,1-2H3,(H,22,23)(H,26,27) |
| InChIKey | ONSAMADRIJWEDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|